주 메뉴 열기

바뀜

편집 요약 없음
{{화합물 정보
| verifiedrevid = 415508036
| 이름 = L-글루타민산나트륨
| 그림 = Monosodium glutamate crystals.jpg
| ImageSize = 200px
| ImageName = Glutamic acid
| IUPAC = 2-hydroxypropane- 1,2,3-tricarboxylic acid
| PubChem = 85314
| InChI = 1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)
| SMILES = C(CC(=O)O)C(C(=O)[O-])N.[Na+]
| InChIKey = WHUUTDBJXJRKMK-UHFFFAOYAD
| CAS = 142-47-2
| CASNo_Ref = {{cascite}}
| ChemSpiderID = 76943 
| UNII = C3C196L9FG 
| EC-번호 = 205-538-1
| RTECS =
|분자식 = C<sub>5</sub>H<sub>8</sub>NNaO<sub>4</sub>
| 분자량 = 169.111
| 상온상태 = 백색 결정질 가루
| 용해도 = 74
|   녹는점= 232
| LD50 = 16600 mg/kg (oral, rat)
}}
'''글루타민산나트륨'''(sodium glutamate) 또는 MSG로도 부르는 L-글루타민산나트륨은 가장 풍부한 자연발생 [[불필수]] [[아미노산]]인 [[글루탐산]]의 [[나트륨염]]이다. <ref name="Ninomiya Food Rev 1998">{{저널 인용 |author= Ninomiya K |제목= Natural ocurrence |journal=Food Reviews International|volume=14 |issue=2&3|pages=177–211 |year=1998 |doi= 10.1080/87559129809541157}}</ref>미국 [[미국 식품의약국|식약청]]은 MSG를 [[GRAS|일반적으로 안전하다고 인식되는 물질]](Generally Recognized as Safe; GRAS)로 판단하며, EU는 [[식품 첨가물|식품첨가물]](food additive)로 다룬다. MSG는 [[HS 코드]] 29224220, [[E 번호|E 번호]]E621이다<ref>http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist</ref>. MSG의 글루타메이트는 다양한 음식에서 같은 우마미 맛을 낸다. 모두 화학적으로 동일하기 때문이다. <ref>{{저널 인용 |author=Ikeda K|제목= New seasonings |journal=Chem Senses |volume=27 |issue=9|pages=847–849 |year=2002 |month=November|pmid=10736352 |doi=10.1093/chemse/27.9.847}}</ref> 식품제조업체들은 MSG를 화학조미료로 마케팅하고 사용한다. MSG가 다른 맛들에 대한 전체 지각을 균형있고 조화롭게 해주기 때문이다. <ref name="Loliger J">{{저널 인용 |author=Loliger J|제목= Function and importance of Glutamate for Savory Foods |journal=[[Journal of Nutrition]] |volume=130 |issue=4s Suppl |pages=915s–920s |year=2000 |month=April |pmid=12438213}}</ref><ref>{{저널 인용 |author=Yamaguchi S|제목= Basic properties of umami and effects on humans |journal=[[Physiology & Behavior]] |volume=49 |issue=5|pages=833–841 |year=1991 |month=May |pmid=1679557 |doi=10.1016/0031-9384(91)90192-Q}}</ref>시장 L-글루타민산나트륨의 상표로는 아지노모토(AJI-NO-MOTO®), 베친(Vetsin), 악센트(Ac'cent.) 등이 있다.