쿠에티아핀: 두 판 사이의 차이
내용 삭제됨 내용 추가됨
잔글 HotCat을 사용해서 분류:도파민 길항제 삭제함 |
편집 요약 없음 |
||
1번째 줄:
{{약 정보
'''쿠에티아핀'''(Quetiapine)은(상품명으로 쎄로켈등이 사용된다) 은 영국 아스트라제네카가 개발한 [[조현병]], [[조울증]] 등 주요 우울 장애 치료의 보조 요법제에 사용되는 비정형적 항정신병제제이다.▼
| Watchedfields = changed
| verifiedrevid = 443404910
| IUPAC_name = 2-(2-(4-dibenzo[''b,f''][1,4]thiazepine- 11-yl- 1-piperazinyl)ethoxy)ethanol
| image = Quetiapine.svg
| image2 = Quetiapine-from-xtal-3D-balls.png
<!--Clinical data-->
| pronounce = {{IPAc-en|k|w|ɨ|ˈ|t|aɪ|.|ə|p|iː|n}} {{respell|kwi|TY|ə-peen}}
| tradename = Seroquel
| Drugs.com = {{drugs.com|monograph|seroquel}}
| MedlinePlus = a698019
| licence_US = Quetiapine
| pregnancy_AU = B3
| pregnancy_US = C
| legal_AU = S4
| legal_US = Rx-only
| legal_UK = POM
| routes_of_administration = Oral
<!--Pharmacokinetic data-->
| bioavailability = 100%<ref name = Medscape />
| metabolism = 간에서 CYP3A4 효소의 설폭시화로 활성 대사산물인 노르쿠에티아핀으로 전환(N-desalkylquetiapine)<ref name = GG>{{cite book|last1=Brunton|first1=L|last2=Chabner|first2=B|last3=Knollman|first3=B|title=Goodman and Gilman’s The Pharmacological Basis of Therapeutics|edition=12th|publisher=McGraw Hill Professional|year=2010|isbn=978-0071624428}}</ref>
| protein_bound = 83%<ref name = EMC>{{cite web|title=Quetiapine 25 mg film-coated tablets - Summary of Product Characteristics|date=January 2013|accessdate = 20 October 2013|work=electronic Medicines Compendium|publisher = Sandoz|url=http://www.medicines.org.uk/emc/medicine/26575/SPC/Quetiapine+25+mg+film-coated+tablets/}}</ref>
| elimination_half-life = 7 시간 (쿠에티아핀); 9–12 시간 (활성상태, 노르쿠에티아핀)<ref name = EMC/>
| excretion = [[신장]] (73%), 대소변 (20%)<ref name = Medscape>{{cite web|title=quetiapine (Rx) - Seroquel, Seroquel XR|url=http://reference.medscape.com/drug/seroquel-xr-quetiapine-342984#10|work=Medscape Reference|publisher=WebMD|accessdate=11 October 2013}}</ref><ref name = EMC/><ref name = DM>{{cite web|title=QUETIAPINE FUMARATE tablet QUETIAPINE FUMARATE (quetiapine fumarate ) tablet [Ascend Laboratories, LLC]|work=DailyMed|publisher=Ascend Laboratories, LLC|date=October 2013|accessdate=26 November 2013|url=http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=3112a006-1c61-47f2-84f5-9a7670d09c9b}}</ref>
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 111974-69-7
| ATC_prefix = N05
| ATC_suffix = AH04
| PubChem = 5002
| IUPHAR_ligand = 50
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01224
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4827
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = BGL0JSY5SI
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08456
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 8707
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 716
<!--Chemical data-->
| C=21 | H=25 | N=3 | O=2 | S=1
| molecular_weight = 383.5099 g/mol
| smiles = N\1=C(\c3c(Sc2c/1cccc2)cccc3)N4CCN(CCOCCO)CC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H25N3O2S/c25-14-16-26-15-13-23-9-11-24(12-10-23)21-17-5-1-3-7-19(17)27-20-8-4-2-6-18(20)22-21/h1-8,25H,9-16H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = URKOMYMAXPYINW-UHFFFAOYSA-N
| solubility = 3.29
}}
▲'''쿠에티아핀
== 효능 및 효과 ==
줄 8 ⟶ 62:
* 양극성 장애와 관련된 조증 및 우울 삽화의 치료 (쿠에티아핀 투여로 조증, 혼재 또는 우울 삽화에 반응을 보인 환자들에 있어서, 양극성 장애의 재발 방지)
* 주요 우울 장애 치료의 보조 요법제 (서방정에 한함)
== 참고 문헌 ==
{{각주|2}}
{{토막글|의학}}
[[분류:정신작용제]]
[[분류:수면제]]
[[분류:진정제]]
[[분류:도파민 길항제]]
[[분류:피페라진]]
[[분류:에터]]
[[분류:알코올]]
| |||