사용자:Enigma7seven/작업장06: 두 판 사이의 차이
내용 삭제됨 내용 추가됨
Enigma7seven (토론 | 기여) 잔글 문서 내용을 ‘<!---->’으로 교체 |
Enigma7seven (토론 | 기여) 잔글편집 요약 없음 |
||
1번째 줄:
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 456689148
| IUPAC_name = 4-amino-''N''-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide
| image = Amisulpride.svg
| width = 250px
| image2 = Amisulpride-xtal-1990-ball-and-stick-model.png
| width2 = 250px
<!--Clinical data-->
| tradename = 솔리안(Solian)
| Drugs.com = {{drugs.com|international|amisulpride}}
| pregnancy_AU = C
| legal_AU = S4
| legal_UK = POM
| routes_of_administration = 경구, 정맥주사
<!--Pharmacokinetic data-->
| bioavailability = 48%<ref name=Rosenzweig>{{ cite journal |author1=Rosenzweig, P. |author2=Canal, M. |author3=Patat, A. |author4=Bergougnan, L. |author5=Zieleniuk, I. |author6=Bianchetti, G. | title = A review of the pharmacokinetics, tolerability and pharmacodynamics of amisulpride in healthy volunteers. | journal = Human Psychopharmacology | volume = 17 | issue = 1 | year = 2002 | pages = 1–13 | pmid = 12404702 | doi = 10.1002/hup.320 }}</ref><ref name = SOLIAN>{{cite web|title=PRODUCT INFORMATION SOLIAN® TABLETS and SOLUTION|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-01659-3|work=TGA eBusiness Services|publisher=Sanofi-Aventis Australia Pty Ltd|accessdate=17 October 2013|format=PDF|date=9 September 2013}}</ref>
| protein_bound = 16%<ref name = SOLIAN/>
| metabolism = [[간]] <ref name = SOLIAN/>
| elimination_half-life = 12 시간<ref name=Rosenzweig/>
| excretion = [[신장]]<ref name=Rosenzweig/> (23–46%),<ref name = BT>{{cite journal|author=Caccia, S|title=Biotransformation of Post-Clozapine Antipsychotics Pharmacological Implications|journal=Clinical Pharmacokinetics|doi=10.2165/00003088-200038050-00002|pmid=10843459|volume=38|issue=5|date=May 2000|pages=393–414}}</ref><ref name = Dys>{{cite journal|title=Amisulpride: A Review of its Clinical Potential in Dysthymia|author1=Noble, S |author2=Benfield, P |journal=CNS Drugs|volume=12|issue=6|date=December 1999|doi=10.2165/00023210-199912060-00005|pages=471–483}}</ref> [[대소변]]<ref name = SOLIAN/>
<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 71675-85-9
| CAS_supplemental =
| ATC_prefix = N05
| ATC_suffix = AL05
| PubChem = 2159
| IUPHAR_ligand = 963
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB06288
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2074
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8110R61I4U
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07310
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 64045
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 243712
<!--Chemical data-->
| C=17 | H=27 | N=3 | O=4 | S=1
| molecular_weight = 369.48 g/mol
| SMILES = O=S(=O)(c1cc(c(OC)cc1N)C(=O)NCC2N(CC)CCC2)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H27N3O4S/c1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/h9-10,12H,4-8,11,18H2,1-3H3,(H,19,21)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NTJOBXMMWNYJFB-UHFFFAOYSA-N
}}
'''아미설피리드'''(Amisulpride)는 [[조현병]] 치료제인 [[비정형 항정신병약]] 이다. 상품명인 '''솔리안'''(Solian) 으로도 알려져 있다. 저용량에서는 [[기분부전장애]] 의 치료에도 사용된다.
{{항정신병제제}}
{{토막글|의학}}
[[분류:비정형적 항정신병제제]]
|