사이티딘 이인산: 두 판 사이의 차이

1,376 바이트 추가됨 ,  2년 전
잔글
봇: 화합물 정보 틀 이관 (chembox 또는 drugbox)
잔글편집 요약 없음
잔글 (봇: 화합물 정보 틀 이관 (chembox 또는 drugbox))
{{chembox
{{화합물 정보
| Verifiedfields = changed
|이름 = 사이티딘 이인산
| verifiedrevid = 443555075
|그림ImageFile = Cytidindiphosphat protoniert.svg
|그림1 =
|ImageAlt = Skeletal formula of cytidine diphosphate
|그림크기 = 250px
|ImageFile1 = Cytidine diphosphate anion 3D spacefill.png
|그림설명 =
|ImageSize1 = 210
|IUPAC = [(2''R'',3''S'',4''R'',5''R'')-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate
|ImageAlt1 = Space-filling model of the Cytidine diphosphate molecule as an anion (3- anion)
|화학식 = C<sub>9</sub>H<sub>15</sub>N<sub>3</sub>O<sub>11</sub>P<sub>2</sub>
|IUPACName=
|분자식 =
|OtherNames=
|별칭 = CDP
|Section1={{Chembox Identifiers
|CAS = 63-38-7
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|원자량 =
| ChemSpiderID = 5902
|분자량 = 403.18
| InChI = 1/C9H15N3O11P2/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
|녹는점 =
| InChIKey = ZWIADYZPOWUWEW-XVFCMESIBF
|끓는점 =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
|밀도 =
| ChEMBL = 425252
|용해도 =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
|용해성 =
| StdInChI = 1S/C9H15N3O11P2/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
|상온상태 =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
|상온색 =
| StdInChIKey = ZWIADYZPOWUWEW-XVFCMESISA-N
|기체 =
|CAS CASNo= 63-38-7
|기체1 =
| CASNo_Ref = {{cascite|correct|CAS}}
|액체 =
| CASNo2_Ref = {{cascite|correct|CAS}}
|액체1 =
| CASNo2 = 54394-9-0
|고체 =
| CASNo2_Comment = (disodium salt) <!-- NOT CAS verified -->
|고체1 =
| CASNo3_Ref = {{cascite|correct|CAS}}
|섭취 =
| CASNo3 = 34393-59-4
|흡입 =
| CASNo3_Comment = (trisodium salt) <!-- NOT CAS verified -->
|피부 =
| UNII_Ref = {{fdacite|correct|FDA}}
|눈 =
| UNII = 1ZH821MXU5
|R-phrase =
| UNII2_Ref = {{fdacite|correct|FDA}}
|기타 =
| UNII2 = F8B9F7OXES
|LD50 =
| UNII2_Comment = (disodium salt)
| UNII3_Ref = {{fdacite|correct|FDA}}
| UNII3 = 0TZ883O8PW
| UNII3_Comment = (trisodium salt)
| PubChem=290
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17239
| SMILES = O=P(O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N/1C(=O)/N=C(/N)\C=C\1)[C@H](O)[C@@H]2O
}}
|Section2={{Chembox Properties
|화학식 Formula= C<sub>9</sub>H<sub>15</sub>N<sub>3</sub>O<sub>11</sub>P<sub>2</sub>
| MolarMass=403.176422
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
 
'''사이티딘 이인산'''({{llang|en|cytidine diphosphate}}, '''CDP''')은 뉴클레오사이드 이인산의 한 종류이다. 사이티딘 이인산은 [[뉴클레오사이드]]인 [[사이티딘]]과 피로인산의 [[에스터]]이다. 사이티딘 이인산은 [[핵염기]]인 [[사이토신]], [[5탄당]]인 [[리보스]], 피로인산으로 구성되어 있다.
 

편집

2,343,937