"아이소류신"의 두 판 사이의 차이

1,172 바이트 추가됨 ,  6개월 전
편집 요약 없음
{{chembox
{{아미노산 정보
| Watchedfields = changed
|상용명=아이소류신
| verifiedrevid = 455157745
|IUPAC명=(2''S'',3''S'')-2-amino-3-methyl-pentanoic acid
| Name = {{sm|l}}-Isoleucine
|영문이름=IsoLeucine
| ImageFileL1 = L-Isoleucin - L-Isoleucine.svg
|분자식={{화학식| C = 6 | H = 13 | N = 1 | O = 2|}}
| ImageNameL1 = Chemical structure of Isoleucine
|분자량=131.18
| ImageFileR1 = L-isoleucine-3D-balls.png
|1자_부호=I
| ImageNameR1 = Chemical structure of Isoleucine
|3자_부호=Ile
| IUPACName = Isoleucine
|분류=비극성, 소수성
|IUPAC명 OtherNames = (2''S'',3''S'')-2-amino-3-methyl-pentanoicmethylpentanoic acid
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 3311
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6067
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 04Y7590D77
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00065
| InChI = 1/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1
| InChIKey = AGPKZVBTJJNPAG-WHFBIAKZBB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AGPKZVBTJJNPAG-WHFBIAKZSA-N
| CASNo = 73-32-5
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 791
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00167
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 58045
| SMILES = CC[C@H](C)[C@@H](C(=O)O)N
| SMILES1 = CC[C@H](C)[C@@H](C(=O)[O-])[NH3+]
| SMILES1_Comment = [[Zwitterion]]
}}
| Section2 = {{Chembox Properties
|분자식={{화학식| C = 6 | H = 13 | N = 1 | O =2 2|}}
| MagSus = −84.9·10<sup>−6</sup> cm<sup>3</sup>/mol
}}
}}
'''아이소류신'''({{lang|en|Isoleucine}}, 아이소류신, 생략하여 IIe, 혹은 I로 쓰기도 한다)<ref>{{웹 인용| author=IUPAC-IUBMB Joint Commission on Biochemical Nomenclature | 제목=Nomenclature and Symbolism for Amino Acids and Peptides | work=Recommendations on Organic & Biochemical Nomenclature, Symbols & Terminology etc | url=http://www.chem.qmul.ac.uk/iupac/AminoAcid/ | accessdate=2007-05-17}}</ref>은 알파 아미노산으로 화학식은 HO<sub>2</sub>CCH(NH<sub>2</sub>)CH(CH<sub>3</sub>)CH<sub>2</sub>CH<sub>3</sub>이다. 아이소류신은 필수 아미노산이며, 이 뜻은 사람은 이걸 합성하지 못하며, 아이소류신을 섭취해야만 된다는 뜻이다. 아이소류신의 [[코돈]]은 AUU, AUC, AUA가 있다.