아드레날린: 두 판 사이의 차이
내용 삭제됨 내용 추가됨
InternetArchiveBot (토론 | 기여) 1 개의 출처 구조, 0 개의 링크를 깨진 것으로 표시 #IABot (v2.0beta9) |
편집 요약 없음 |
||
1번째 줄:
{{다른 뜻}}
{{drugbox
| Watchedfields = changed
| verifiedrevid = 464189734
| BAN=adrenaline
| IUPAC_name = (''R'')-4-(1-Hydroxy-2-(methylamino)ethyl)benzene-1,2-diol
| image = Epinephrine.svg
| width = 240
| alt = Skeletal formula of adrenaline
| image2 = Adrenaline molecule ball from xtal.png
| alt2 = Ball-and-stick model of adrenaline molecule
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism = [[synapse|adrenergic synapse]] ([[Monoamine oxidase|MAO]] and [[Catechol-O-methyl transferase|COMT]])
| onset = Rapid<ref name=AHFS2015/>
| elimination_half-life = 2 minutes
| duration_of_action= Few minutes<ref>{{cite book|title=Nancy caroline's emergency care in the streets.|date=2012|publisher=Jones And Bartlett Learning|location=[S.l.]|isbn=9781449645861|page=557|edition=7th|url=https://books.google.com/books?id=7uk0GJckmy0C&pg=PA557}}</ref>
| excretion = Urine
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 51-43-4
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28918
| PubChem = 5816
| IUPHAR_ligand = 479
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00668
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5611
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YKH834O4BH
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00095
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 679
| PDB_ligand = ALE
<!--Chemical data-->
| C=9 | H=13 | N=1 | O=3
| molecular_weight = 183.204 g/mol
| smiles = CNC[C@H](O)C1=CC=C(O)C(O)=C1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UCTWMZQNUQWSLP-VIFPVBQESA-N
| drug_name=
| caption=
| type=
| legal_status=
| licence_EU=
| pregnancy_AU=
| pregnancy_category=
| density=1.283±0.06
| density_notes = @ 20 °C, 760 Torr
<!-- | Enthalpy of Vaporization=70.21±3.0kJ/mol @ Press: 760 Torr
| Flash Point=207.9±17.9 °C
--> }}
'''아드레날린'''({{llang|en|adrenaline}}) 또는 '''에피네프린'''({{llang|en|epinephrine}})은 일종의 [[호르몬]], [[신경전달물질]]이다. 또 이 물질은 [[아미노산]] [[페닐알라닌]]과 [[티로신]]에서 가져온 "[[교감신경 흥분제|교감신경 흥분]] [[모노아민]]"인 [[카테콜아민]]이다. 화학식은 C<sub>9</sub>H<sub>13</sub>NO<sub>3</sub>이다.
|